Drugs present in MMsINC which are similar to the molecule MMscode: MMs02358928
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.85 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.77 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.77 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.76 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.73 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.73 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.73 |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.72 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.71 |