Drugs present in MMsINC which are similar to the molecule MMscode: MMs02357239
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725198![]() | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CC | 0.79 |
MMs01727142![]() | O(C(=O)C1C(C(C(OC)=O)C(=NC1=C)C)c1ccccc1[N+](=O)[O-])CC(C)C | 0.79 |
MMs01726865![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.72 |
MMs01726866![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.72 |
MMs01727124![]() | O(C(=O)C=1C(C(C(OC)=O)C(=NC=1C)C)c1cc([N+](=O)[O-])ccc1)CCN(Cc1ccccc1)C | 0.72 |







