Drugs present in MMsINC which are similar to the molecule MMscode: MMs02354049
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724890![]() | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.85 |
MMs01725685![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.78 |
MMs01725683![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.78 |
MMs01725798![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.77 |
MMs01725672![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.77 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01727381![]() | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725225![]() | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |