Drugs present in MMsINC which are similar to the molecule MMscode: MMs02353567
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.84 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.79 |
MMs01725061 | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.76 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.74 |
MMs01724739 | [NH+]=1CCNC=1C1CC1(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.73 |
MMs01725725 | o1nc(nc1NCCN(CCCC)CCCC)-c1ccccc1 | 0.72 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.71 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.71 |