Drugs present in MMsINC which are similar to the molecule MMscode: MMs02338610
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.74 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01727028 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.73 |
MMs01727029 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.73 |
MMs01727030 | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.73 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01726108 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.71 |
MMs01726106 | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.71 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |