Drugs present in MMsINC which are similar to the molecule MMscode: MMs02333972
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725504 | OCC(NCCNC(CC)CO)CC | 0.75 |
MMs01725506 | OCC(NCCNC(CC)CO)CC | 0.75 |
MMs01725693 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726919 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726920 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |
MMs01726921 | ClCCNCC(O)C(O)C(O)C(O)CNCCCl | 0.71 |