Drugs present in MMsINC which are similar to the molecule MMscode: MMs02332404
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726865![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.76 |
MMs01726866![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.76 |
MMs01725247![]() | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.75 |
MMs01724849![]() | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.71 |
MMs01725683![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |
MMs01725685![]() | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |