Drugs present in MMsINC which are similar to the molecule MMscode: MMs02326823
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724900![]() | Oc1c2c(cccc2)c(O)cc1C | 0.85 |
MMs01726687![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.74 |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.74 |
MMs01726713![]() | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726710![]() | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726711![]() | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726712![]() | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01725451![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.71 |
MMs01726704![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.71 |
MMs01726706![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.71 |
MMs01726708![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.71 |