Drugs present in MMsINC which are similar to the molecule MMscode: MMs02322945
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.79 |
MMs01725781![]() | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.77 |
MMs01727079![]() | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.77 |
MMs01727080![]() | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.77 |
MMs01727081![]() | O1c2c(C3C(CCC(=O)C3)C1(C)C)c(O)cc(c2)C(CCCCCC)(C)C | 0.77 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.74 |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.74 |









