Drugs present in MMsINC which are similar to the molecule MMscode: MMs02322293
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725788![]() | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.81 |
MMs01724846![]() | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.80 |
MMs01725249![]() | Clc1ccc(cc1)C1CCC(CC1)C1C(=O)C(=O)c2c(cccc2)C1=O | 0.77 |
MMs01724741![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.74 |
MMs01726475![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.74 |