Drugs present in MMsINC which are similar to the molecule MMscode: MMs02321393
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725440![]() | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.86 |
MMs01725433![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.79 |
MMs01725794![]() | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.79 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.79 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.78 |
MMs01725393![]() | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.78 |
MMs01724845![]() | Brc1ccccc1C[N+](CC)(C)C | 0.74 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725390![]() | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.73 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.72 |
MMs01725536![]() | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.72 |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.72 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |