Drugs present in MMsINC which are similar to the molecule MMscode: MMs02320344
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726808![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.75 |
MMs01726810![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.75 |
MMs01726812![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.75 |
MMs01725124![]() | OC(=O)C(N)CC(C)C | 0.71 |
MMs01725504![]() | OCC(NCCNC(CC)CO)CC | 0.70 |
MMs01725506![]() | OCC(NCCNC(CC)CO)CC | 0.70 |