Drugs present in MMsINC which are similar to the molecule MMscode: MMs02316771
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725027 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.85 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.85 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.74 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.74 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.74 |
MMs01724860 | Clc1ccccc1CC([NH3+])(C)C | 0.71 |
MMs01725249 | Clc1ccc(cc1)C1CCC(CC1)C1C(=O)C(=O)c2c(cccc2)C1=O | 0.71 |
MMs01724898 | Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)C | 0.71 |