Drugs present in MMsINC which are similar to the molecule MMscode: MMs02314226
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.79 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.78 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.73 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.72 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01726742 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.70 |
MMs01724759 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.70 |