Drugs present in MMsINC which are similar to the molecule MMscode: MMs02312726
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.83 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.83 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.77 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.72 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.71 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.70 |