Drugs present in MMsINC which are similar to the molecule MMscode: MMs02311566
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724759![]() | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.77 |
MMs01724797![]() | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.77 |
MMs01725805![]() | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.77 |
MMs01726742![]() | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.77 |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.71 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |