Drugs present in MMsINC which are similar to the molecule MMscode: MMs02311486
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.73 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.73 |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.73 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.71 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.70 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.70 |