Drugs present in MMsINC which are similar to the molecule MMscode: MMs02310369
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724998![]() | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.75 |
MMs01725025![]() | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.75 |
MMs01724762![]() | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.74 |
MMs01725449![]() | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.72 |
MMs01725860![]() | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.72 |
MMs01725790![]() | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.72 |
MMs01725638![]() | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.72 |
MMs01725611![]() | O=C1NC(=Nc2ncc(nc12)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.72 |
MMs01725677![]() | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.71 |
MMs01725418![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.70 |
MMs01725203![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.70 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01726044![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.70 |