Drugs present in MMsINC which are similar to the molecule MMscode: MMs02308060
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727057 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.81 |
MMs01727059 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.81 |
MMs01725096 | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.77 |
MMs01726743 | Clc1ccc(cc1)-c1nc(sc1C(O)=O)-c1ccccc1 | 0.72 |
MMs01724724 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.70 |
MMs01725708 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.70 |