Drugs present in MMsINC which are similar to the molecule MMscode: MMs02303874
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.76 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.75 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.71 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |