Drugs present in MMsINC which are similar to the molecule MMscode: MMs02300358
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725268 | OC(=O)C(N)CCC(O)=O | 0.73 |
MMs01725441 | OC(=O)C(N)CCC(O)=O | 0.73 |
MMs01726808 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.70 |
MMs01726810 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.70 |
MMs01726812 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.70 |