Drugs present in MMsINC which are similar to the molecule MMscode: MMs02293278
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725125 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.89 |
MMs01725127 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.89 |
MMs01725527 | O=C1NC(=Nc2n(cnc12)COCCOC(=O)C(N)C(C)C)N | 0.77 |
MMs01725082 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.76 |
MMs01725083 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.76 |
MMs01724827 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)CN(CCO)C)C | 0.75 |
MMs01725809 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725833 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |