Drugs present in MMsINC which are similar to the molecule MMscode: MMs02282089
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.73 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.72 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.72 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725734 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.70 |
MMs01725733 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.70 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.70 |
MMs01725735 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.70 |