Drugs present in MMsINC which are similar to the molecule MMscode: MMs02259512
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01724818 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.72 |
MMs01727442 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.72 |
MMs01727220 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01724917 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01725372 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01727222 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01724922 | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.70 |