Drugs present in MMsINC which are similar to the molecule MMscode: MMs02258090
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.78 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.78 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.78 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.74 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.73 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.72 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.72 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.71 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.71 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.71 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.70 |