Drugs present in MMsINC which are similar to the molecule MMscode: MMs02257495
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.73 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.73 |
MMs01724751![]() | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.71 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |