Drugs present in MMsINC which are similar to the molecule MMscode: MMs02254896
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724741![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.82 |
MMs01726475![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.82 |
MMs01724846![]() | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.81 |
MMs01724797![]() | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.75 |
MMs01725805![]() | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.75 |
MMs01724759![]() | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.75 |
MMs01726742![]() | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.75 |