Drugs present in MMsINC which are similar to the molecule MMscode: MMs02254215
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.77 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.77 |
MMs01725668![]() | Oc1ccc(cc1)CC(N)C | 0.76 |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.73 |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.73 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01724978![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.72 |
MMs01725298![]() | [NH3+]C1CC1c1ccccc1 | 0.72 |
MMs01725649![]() | [NH3+]C1CC1c1ccccc1 | 0.72 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725664![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01725023![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01724903![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01725662![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01725715![]() | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.70 |