Drugs present in MMsINC which are similar to the molecule MMscode: MMs02253503
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725788![]() | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.76 |
MMs01725392![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.74 |
MMs01724743![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.74 |
MMs01726519![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.74 |
MMs01726518![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.74 |
MMs01724846![]() | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.72 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.71 |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.71 |
MMs01724741![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.70 |
MMs01726475![]() | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.70 |