Drugs present in MMsINC which are similar to the molecule MMscode: MMs02249714
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725118![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.81 |
MMs01724770![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CCC[N+](C1)(C)C | 0.81 |
MMs01726477![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1C2CC[N+](C1)(CC2)C | 0.78 |
MMs01725540![]() | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.75 |
MMs01725542![]() | O(C(=O)C(O)(C1CCCCC1)c1ccccc1)CC#CCN(CC)CC | 0.75 |
MMs01725189![]() | O(C(=O)C(O)(c1ccccc1)c1ccccc1)C1CC2[N+]3(C(C1)CC2)CCCC3 | 0.72 |
MMs01725086![]() | O(CC1=NCCCN1C)C(=O)C(O)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |