Drugs present in MMsINC which are similar to the molecule MMscode: MMs02232125
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725803![]() | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.82 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.80 |
MMs01724739![]() | [NH+]=1CCNC=1C1CC1(c1ccccc1)c1ccccc1 | 0.77 |
MMs01725061![]() | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.73 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.72 |
MMs01725393![]() | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |
MMs01725536![]() | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.70 |