Drugs present in MMsINC which are similar to the molecule MMscode: MMs02230355
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.76 |
MMs01725897![]() | O(C)c1cc(C)c(\C=C\C(=C/C=C/C(=C\C(O)=O)/C)\C)c(C)c1C | 0.73 |
MMs01725108![]() | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.71 |
MMs01724900![]() | Oc1c2c(cccc2)c(O)cc1C | 0.71 |
MMs01726700![]() | O(C(=O)CCCC)C1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.70 |
MMs01726701![]() | O(C(=O)CCCC)C1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.70 |
MMs01726702![]() | O(C(=O)CCCC)C1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.70 |
MMs01726703![]() | O(C(=O)CCCC)C1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.70 |