Drugs present in MMsINC which are similar to the molecule MMscode: MMs02227642
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.90 |
MMs01724782![]() | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.83 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.81 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.80 |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.79 |
MMs01725632![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.79 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.78 |
MMs01725932![]() | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.74 |
MMs01726073![]() | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.74 |
MMs01724876![]() | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.73 |
MMs01725625![]() | Clc1ccc(cc1)C(=O)CN(CCCN1c2c(CCc3c1cccc3)cccc2)C | 0.71 |
MMs01724926![]() | O=C1N=C(c2c(N1C(C)C)cc(cc2)C)c1ccccc1 | 0.71 |
MMs01725061![]() | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.70 |
MMs01724924![]() | Clc1cc2c(N(CC3CC3)C(=O)CN=C2c2ccccc2)cc1 | 0.70 |