Drugs present in MMsINC which are similar to the molecule MMscode: MMs02183323
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727448 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.73 |
MMs01727445 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.73 |
MMs01727446 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.73 |
MMs01727447 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.73 |
MMs01727116 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727118 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727120 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727122 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |