Drugs present in MMsINC which are similar to the molecule MMscode: MMs02183098
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.73 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.72 |
MMs01727114 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.70 |
MMs01727115 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.70 |
MMs01727112 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.70 |
MMs01727113 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.70 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.70 |