Drugs present in MMsINC which are similar to the molecule MMscode: MMs02179137
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.81 |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.80 |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.80 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.77 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.77 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.77 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.77 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.74 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.74 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.74 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.74 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.74 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.73 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.72 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.71 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.71 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.71 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |
MMs01724898 | Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)C | 0.70 |