Drugs present in MMsINC which are similar to the molecule MMscode: MMs02178719
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.74 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.74 |
MMs01724846![]() | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.73 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.72 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725788![]() | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.71 |