Drugs present in MMsINC which are similar to the molecule MMscode: MMs02178014
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725451![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.73 |
MMs01726704![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.73 |
MMs01726706![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.73 |
MMs01726708![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.73 |
MMs01727383![]() | Brc1c(Br)c(Br)c2c(C(OC2=O)(c2cc(S(O)(=O)=O)c(O)cc2)c2cc(S(O)(=O)=O)c(O)cc2)c1Br | 0.71 |