Drugs present in MMsINC which are similar to the molecule MMscode: MMs02175376
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724928![]() | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.78 |
MMs01724762![]() | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.76 |
MMs01725826![]() | S(=O)(=O)(N)c1ccc(-n2nc(cc2-c2ccc(cc2)C)C(F)(F)F)cc1 | 0.72 |
MMs01724945![]() | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.72 |
MMs01727286![]() | [n+]1(c2c(cc(N(C)C)cc2)ccc1\C=C\c1cc(n(c1C)-c1ccccc1)C)C | 0.71 |