Drugs present in MMsINC which are similar to the molecule MMscode: MMs02147495
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.81 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.81 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.80 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.80 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.79 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.79 |
MMs01726878 | Ic1c(C(=O)NC)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.71 |
MMs01725685 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |
MMs01725683 | OC(=O)C(CCCC)C(=O)N(Nc1ccccc1)c1ccccc1 | 0.71 |
MMs01725672 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.70 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.70 |
MMs01726865 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.70 |
MMs01726866 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.70 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.70 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.70 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.70 |