Drugs present in MMsINC which are similar to the molecule MMscode: MMs02146860
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724816![]() | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.79 |
MMs01724957![]() | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.79 |
MMs01724997![]() | S(=O)(=O)(C)c1ccc(cc1)C=1COC(=O)C=1c1ccccc1 | 0.76 |
MMs01727385![]() | S(=O)(C)c1ccc(cc1)\C=C/1\c2c(cc(F)cc2)C(CC(O)=O)=C\1C | 0.73 |
MMs01725788![]() | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.71 |