Drugs present in MMsINC which are similar to the molecule MMscode: MMs02126001
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725809![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725833![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725954![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725956![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725766![]() | Oc1cc(cc(O)c1)C(O)CNCCCn1c2c(nc1)N(C)C(=O)N(C)C2=O | 0.70 |