Drugs present in MMsINC which are similar to the molecule MMscode: MMs02125932
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.80 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.75 |
MMs01727180 | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.74 |
MMs01727179 | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.74 |
MMs01725133 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01726473 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01724857 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.73 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.71 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |