Drugs present in MMsINC which are similar to the molecule MMscode: MMs02125361
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.83 |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.83 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.77 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.77 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.72 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.72 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.71 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.71 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |