Drugs present in MMsINC which are similar to the molecule MMscode: MMs02125133
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725063![]() | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.75 |
MMs01724846![]() | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.72 |
MMs01725538![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725773![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725828![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |