Drugs present in MMsINC which are similar to the molecule MMscode: MMs02104669
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724928 | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.75 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.73 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.73 |
MMs01727286 | [n+]1(c2c(cc(N(C)C)cc2)ccc1\C=C\c1cc(n(c1C)-c1ccccc1)C)C | 0.73 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.71 |
MMs01724762 | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.71 |
MMs01725826 | S(=O)(=O)(N)c1ccc(-n2nc(cc2-c2ccc(cc2)C)C(F)(F)F)cc1 | 0.71 |
MMs01724945 | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.71 |
MMs01724834 | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 0.70 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.70 |
MMs01724924 | Clc1cc2c(N(CC3CC3)C(=O)CN=C2c2ccccc2)cc1 | 0.70 |