Drugs present in MMsINC which are similar to the molecule MMscode: MMs02093432
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.83 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.75 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.74 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.74 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.73 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.73 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.72 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.72 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.72 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.71 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.71 |
MMs01724794 | O1C(c2ccccc2)C(=O)N=C1N | 0.70 |