Drugs present in MMsINC which are similar to the molecule MMscode: MMs02037214
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.72 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |