Drugs present in MMsINC which are similar to the molecule MMscode: MMs02036596
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726357 | S1C2N(C(=O)C2NC(=O)\C(=N\OC)\c2occc2)C(C(O)=O)=C(C1)COC(=O)N | 0.73 |
MMs01726359 | S1C2N(C(=O)C2NC(=O)\C(=N\OC)\c2occc2)C(C(O)=O)=C(C1)COC(=O)N | 0.73 |
MMs01726361 | S1C2N(C(=O)C2NC(=O)\C(=N\OC)\c2occc2)C(C(O)=O)=C(C1)COC(=O)N | 0.73 |
MMs01726363 | S1C2N(C(=O)C2NC(=O)\C(=N\OC)\c2occc2)C(C(O)=O)=C(C1)COC(=O)N | 0.73 |
MMs01726365 | S1C2N(C(=O)C2NC(=O)\C(=N/OC)\c2occc2)C(C(OC(OC(=O)C)C)=O)=C(C1)COC(=O)N | 0.72 |
MMs01726366 | S1C2N(C(=O)C2NC(=O)\C(=N/OC)\c2occc2)C(C(OC(OC(=O)C)C)=O)=C(C1)COC(=O)N | 0.72 |
MMs01726367 | S1C2N(C(=O)C2NC(=O)\C(=N/OC)\c2occc2)C(C(OC(OC(=O)C)C)=O)=C(C1)COC(=O)N | 0.72 |
MMs01726368 | S1C2N(C(=O)C2NC(=O)\C(=N/OC)\c2occc2)C(C(OC(OC(=O)C)C)=O)=C(C1)COC(=O)N | 0.72 |