Drugs present in MMsINC which are similar to the molecule MMscode: MMs02006071
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.84 |
MMs01725061 | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.78 |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.77 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.76 |
MMs01724862 | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.74 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.70 |